Halogens are destructive to ozone because they are highly reactive with oxygen. select the best answer from the choices provided t f

True

Explanation:

Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.

When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.

c. earths continental crust is thicker than its lithosphere.

because, the lithosphere is the outermost layer of the earth/ 100 km thick and is defined by its machanical properties.the lithosphere contains oceanic and continental crust that varies in age and thickness across locations and geologic time. the lithosphere is the coolest layer of the earth in terms of temperature. the term lithosphere should not be confused with the use of "geosphere" which is used to indicate all of earth systems, including the atmosphere, hydrosphere   and biosphere. the surface of the earth can be divided into the continental crust and the oceanic crust.   the continental crust is made mostly of granite while the oceanic crust is made of basalt. the average thickness of the continental crust is 25 miles and the average thickness of the oceanic crust is 5 miles.   three types of rock, igneous, sedimentary, and metamorphic, make up the surface of the earth. that's why 3 option is preferable.