Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

Explanation:

CO2 + H2O = C6H12O6 + O2 + H2O

Starting carbon atoms,

1C on reactants and 6C on products,

therefore you should start by putting a 6 on CO2

6CO2 + H2O = C6H12O6 + O2 + H2O

Proceed with Hydrogen,

Reactants → 2H

Products → 14H

You should multiply H2O with 7 .

6CO2 + 7H2O = C6H12O6 + O2 + H2O

the we need to proceed for Oxygen,

Reactants → 12 + 7= 19O

Products → 6 O in C6H12O6, 2O in O2 and 1O in H2O

we need to balance the equation without disrupting the balance of other atoms, so we need to Multiply O2 with 6

The required balanced equation is  

6CO2 + 7H2O = C6H12O6 + 6O2 + H2O

a chemical reaction

explanation:

a saline water is fed to a reverse osmosis unit at flow rate o rotameter connected to reject (retentate) line reads 8 installed in reject and permeate line reads 15.2 milli siemens/cm and 300 micro siemens/com respectively.