When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind of compound is the major organic product

hope this

explanation:

covalent bonds

consist of pairs of electrons shared by two atoms, and bind the atoms to fixed orientation and requre high energies to break them

ionic bonds

when two atoms differ considerably in their electronegativity, then one of the atoms will lose its electron to the other atom. this results in a positively charged ion(cation) and a negatively charged ion (anion)

the answer is symmetrical : )