Photolithography is the process by which we make the tiny circuits necessary for the tiny transistors in today’s electronics. To do this we must create very thin films of a chemical burn carveout channels that are filled with metal to creat the circuits. One posible candidate for making these thin films is butyltin trichloride, C4H9SnCl3. In the presence water this chemical loosens some of its bound chloride atoms producing hydrochloric acid HCI, arrording to the chemical equation below C4H9SnCl3+H2O=C4H9Sn(OH)2Cl+HCl

You are attempting to recrystallize a crude product mixture. you add the appropriate amount of hot solvent and are allowing the solution to slowly cool to room temperature. however, at room temperature no crystals have appeared, which of the following methods should be used to induce crystallization? choose all correct answers. a) place the flask in an ice bath. b) swirl the contents of the flask. c) add a small seed crystal of the desired product. d) scratch the inside of the glassware using a stir rod. it can be multiple choices