Chemistry, 30.04.2021 19:10 Ilcienne6590
Arrange the following fatty acids from the highest melting point to the lowest melting point.
a. CH3(CH2)12COOH
b. CH3(CH2)16COOH
c. CH3CH2(CH=CHCH2)3(CH2)6COOH
d. CH3(CH2)5CH=CH(CH2)7COOH
Select all of the statements about fatty acid melting points that are true.
a. A saturated fatty acid with a greater molar mass has a higher melting point than a saturated fatty acid with a lower molar mass.
b. A saturated fatty acid with a greater molar mass has a lower melting point than a saturated fatty acid with a lower molar mass.
c. A saturated fatty acid has a higher melting point than an unsaturated fatty acid.
d. A saturated fatty acid has a lower melting point than an unsaturated fatty acid.
Answers: 3
Chemistry, 22.06.2019 19:30
Describe the forces both attractive and repulsive that occur as two atoms move closer together.
Answers: 1
Chemistry, 23.06.2019 03:00
What volume does 1.70 ×10–3 mol of chlorine gas occupy if its temperature is 20.2 °c and its pressure is 795 mm hg?
Answers: 3
Chemistry, 23.06.2019 03:30
If 2 molecules of one reactant combine with 3 molecules of another to produce 5 molecules of a product, then what is the representation of the reaction?
Answers: 1
Arrange the following fatty acids from the highest melting point to the lowest melting point.
a. C...
Mathematics, 09.07.2019 03:00
Biology, 09.07.2019 03:00
Spanish, 09.07.2019 03:00
Arts, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Biology, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
History, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00
Mathematics, 09.07.2019 03:00