Balance Ni(NO3)2+Na2CrO4=NiCrO4+Na(NO3)2

Remember to use the proper number of significant figures and leading zeros in all calculations.gelatin has a density of 1.27 g/cm³. if you have a blob of gelatin dessert that fills a 2.0 liter bottle, what is its mass? 2540 g2500 g3.9 x 10-43.937x 10-4

Table sugar completely dissolved in water is an example of a?

2-bromo-2-methylbutane undergoes an e1 elimination reaction in the presence of ethanol. in the next reaction only one of the possible products is represented. although the product shown is not the major product of the reaction, notice that there is more than one way it can be produced. complete the mechanism and draw the missing substances.