The+density+of+a+56. 0%+(mass)+aqueous+solution+of+1-pro panol+(ch3ch2ch2oh)+is+0. 8975+g/cm3. +what+is+the+molarity+of+the+soluti on?.

girl imma just put my comment here because i need a couple point okurrttt

a. energy is absorbed in the reaction.

if in a given reaction the energy of products is greater than the energy of reactants it means that reaction is endothermic and during the reaction, the energy is absorbed by reactants. in an endothermic reaction, the products have more stored chemical energy than the reactants. and in this reaction the reactants are more stable than products before the compounds with less energy are always more stable.

substituting a hydrogen atom with a halogen in a hydrocarbon:

- the single bond remains single. a is wrong.

- the bond with hydrogen is as strong as with a halogen. c is wrong

- a hydrocarbon is saturated if there is no double bond. we do not know that so d is wrong.

- carbon will always have four valence electrons. e is wrong.

by elimination, the correct answer is b. the boiling point of the new compound increases.