Why are carbon dioxide concentrations expected to increase? a. carbon dioxide concentrations are expected to increase, because fossil fuel burning is expected to increase. b. carbon dioxide concentrations are expected to increase, because of an increase in agriculture. c. carbon dioxide concentrations are expected to increase, because more land will have to be cleared for increasing populations and agricultural use. d. all of the above

The correct option is D.
Over the past decades, the concentration of carbon dioxide in the atmosphere has increased greatly as a result of human activities. The major human activity that contributes to increase in the concentration of atmospheric carbon dioxide is the burning of fossil fuels. Carbon dioxide concentrations in the atmosphere are still expected to rise due to fossil fuel burning and clearing of farm land in agriculture.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Yes