Physics, 28.06.2019 17:30 nancy00

Ball a of mass 5.0 kilograms moving at 20 meters per second collides with ball b of unknown mass moving at 10 meters per second in the same direction. after the collision, ball a moves at 10 meters per second and ball b at 15 meters per second, both still in the same direction. what is the mass of ball b? * 1 point your answer

Answers: 1

Show answers

Answers

Answer from: graycelynn123

M = mass of the ball A = 5.0 kg

m = mass of the ball B = ?

V = initial velocity of the ball A before collision = 20 m/s

v = initial velocity of the ball B before collision = 10 m/s

V' = final velocity of the ball A after collision = 10 m/s

v' = final velocity of the ball B after collision = 15 m/s

using conservation of momentum

M V + m v = M V' + m v'

(5.0) (20) + m (10) = (5.0) (10) + m (15)

100 + 10 m= 50 + 15 m

5 m = 50

m= 10 m/s

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

When is this

Another question on Physics

Physics, 22.06.2019 06:30

How much force was applied to an object if was moved 2 meters and the work done on the object was 8 joules? a. 0.25 n b. 4 n c. 6 n d. 16 n

Answers: 1

Answer

Physics, 22.06.2019 08:00

Tafari worked one summer on a ship that set weather buoys in the ocean. he watched how one of the buoys moved in the water. describe which parts of the wave would cause the buoy to bob up and down. which wave property determined how fast the buoys bobbed in the water? he observed that when the wind blew harder, the ocean waves were larger, and the buoys moved away from the ship. what effect, if any, did the waves have on how far the buoys moved? explain your answer.

Answers: 3

Answer

Physics, 22.06.2019 14:50

Nitrogen (n2) undergoes an internally reversible process from 6 bar, 247°c during which pν1.2 = constant. the initial volume is 0.1 m3 and the work for the process is 121.14 kj. assuming ideal gas behavior, and neglecting kinetic and potential energy effects, determine heat transfer, in kj, and the entropy change, in kj/s. show the process on a t-s diagram.

Answers: 2

Answer

Physics, 22.06.2019 15:50

The california mussel (mytilus californianus) attaches itself to a rock or other solid surface with a bundle of filaments known as the byssus. imagine that 15.0 j of work is done to stretch the distal end of the byssus. it releases 10.8 j of thermal energy as it relaxes. what is the resilience of the distal end of the byssus?

Answers: 2

Answer

You know the right answer?

Ball a of mass 5.0 kilograms moving at 20 meters per second collides with ball b of unknown mass mov...

Questions