Physics, 27.06.2019 18:30 Weaj01

Explain the increase in pressure of a gas when its volume is decreased at constant temperature.

Answers: 1

Show answers

Answers

For a gas held at constant temperature, we can apply Boyle's law, which states that the product between the gas pressure and its volume is constant:

PV=const.

where

P is the pressure

V is the volume

As we see from the equation, P and V are inversely proportional to each other: this means that when the volume is decreased, the pressure increases, and vice-versa. The reason for that is that when the volume is decreased, the gas is compressed, so the molecules of the gas come closer to each other, so they collide more frequently with the wall of the container, exerting therefore a greater pressure.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Apossible long term health effects of stress would be work

Another question on Physics

Physics, 22.06.2019 00:00

(science)study the following ocean currents map. an ocean currents map is shown. on the map the locations for san diego, california and savannah, georgia are marked. there is a looping current from the north past san diego and a looping current from the south near savannah which statement is most likely correct about the average temperatures in san diego, california as compared to savannah, georgia? it is higher in savannah because of the cool ocean currents from the south. it is higher in savannah because of the warm ocean currents from the north. it is lower in san diego because of the warm ocean currents from the south. it is lower in san diego because of the cool ocean currents from the north.

Answers: 2

Answer

Physics, 22.06.2019 06:40

How does the kinetic energy of a charge change as the charge moves under the effect of an electric field from higher potential to lower potential? a.the kinetic energy increases.b.the kinetic energy decreases.c.the kinetic energy remains the same.d.the kinetic energy is always zero.

Answers: 1

Answer

Physics, 22.06.2019 17:30

Which of the choices are parts of an atom? select all that apply. a.) compound b.) electron c.) neutron d.) molecule e.) photon f.) proton g.) element

Answers: 1

Answer

Physics, 23.06.2019 10:30

Suppose your surface body temperature averaged 90 degrees f. how much radiant energy in w/m^2 would be emitted from your body?

Answers: 1

Answer

You know the right answer?

Explain the increase in pressure of a gas when its volume is decreased at constant temperature....

Questions