Physics, 14.09.2019 11:30 lamontcarter

What is the net electrostatic force (magnitude and direction) on a particle with charge +5μc situated at the apex of an equili! ateral triangle if each of the other corners contain identical charges of-6 μc and the length of a side of the triangle is 0.10 m?

Answers: 2

Show answers

Answers

Answer from: jholland03

net electrostatic force = 46.76 N

and direction is vertical downward

Explanation:

given data

charge = +5μC

corners identical charges = -6 μC

length of side = 0.10 m

to find out

What is the net electrostatic force

solution

here apex is the vertex where the two sides of equal length meet

so upper point A have charge +5μC and lower both point B and C have charge -6 μC

force between +5μC and -6 μC is express as

force = $k \frac{q1q2}{r^2}$ ..............1

put here electrostatic constant k = 9 × $10^{9}$ Nm²/C² and q1 q2 is charge given and r is distance 0.10 m

force = $9*10^{9} \frac{5*6*10^(-12)}{0.10^2}$

force = 27 N

so net force is vector addition of both force

force = $\sqrt{x^{2}+x^{2}+2x^{2}cos60}$

here x is force 27 N

force = $\sqrt{27^{2}+27^{2}+2(27)^{2}cos60}$

net electrostatic force = 46.76 N

and direction is vertical downward

What is the net electrostatic force (magnitude and direction) on a particle with charge +5μc situate

Answer from: Quest

the focus of lesson 1 is newton's first law of motion - sometimes referred to as the law of inertia. newton's first law of motion is often stated as. an object at rest stays at rest and an object in motion stays in motion with the same speed and in the same direction unless acted upon by an unbalanced force.

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 16:30

What happens when you slowly pulled the carboard?

Answers: 2

Answer

Physics, 22.06.2019 16:30

The total amount of energy contained in an object

Answers: 3

Answer

Physics, 22.06.2019 20:30

Aball is thrown from the top of a building with an initial velocity of 21.9 m/s straight upward, at an initial height of 51.6 m above the ground. the ball just misses the edge of the roof on its way down, as shown in the figure. (a) determine the time needed for the ball to reach its maximum height. (b) determine the maximum height. (c) determine the time needed for the ball to return to the height from which it was thrown, and the velocity of the ball at that instant. (d) determine the time needed for the ball to reach the ground. (e) determine the velocity and position of the ball at t = 5.35 s.

Answers: 1

Answer

Physics, 23.06.2019 00:40

Researchers conducted an experiment to identify the effects of three different hand sanitizers on the growth of bacteria. the researchers grew one type of bacteria in twenty-four identical covered petri dishes. then, they opened eighteen petri dishes and applied the three hand sanitizers to six petri dishes each. they left the remaining six petri dishes closed as a control group. when the researchers measured the growth of bacteria two days later, the six dishes that had no hand sanitizer showed the least amount of bacterial growth. the researchers concluded that not using any hand sanitizer would lead to the least bacterial growth. which statement best explains why the researchers’ conclusion was not justified? the experiment tested too many variables. the control group was not treated the same as the experimental group. the sample size of twenty-four petri dishes is not large enough. the single type of bacteria is not adequate to make any conclusions.

Answers: 1

Answer

You know the right answer?

What is the net electrostatic force (magnitude and direction) on a particle with charge +5μc situate...

Questions