Aplane nozzle discharges vertically downward to atmosphere. the nozzle is supplied with a steady flow of water. a stationary, inclined, flat plate, located beneath the nozzle, is struck by the water stream. the water stream divides and flows along the inclined plate; the two streams leaving the plate are of unequal thickness. frictional effects are negligible in the nozzle and in the flow along the plate surface. evaluate the minimum gage pressure required at the nozzle inlet. calculate the magnitude and direction of the force exerted by the water stream on the inclined plate. sketch the pressure distribution along the surface of the plate. explain why the pressure distribution is shaped the way you sketched it. consider the nozzle to be 1 m in depth into the plane of the paper.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

    5.5 n======    assuming that      we have      m = 0.145 kg    a = 38 m/s²therefore    5.51 n, but two significant figures.final answer: 5.5 n

The answer is water molecules are split.cellular respiration and photosynthesis are complement  reactions to each other. these are reverse reactions. in cellular respiration glucose and oxygen yield water and carbon dioxide. so, when respiration begins,  glucose molecules are split. in the opposite reaction - in photosynthesis, carbon dioxide and water yield glucose and oxygen. thus,  when respiration begins, water molecules are split.