Iron has a mass of 7.87 g per cubic centimeter of volume, and the mass of an iron atom is 9.27 × 10-26 kg. if you simplify and treat each atom as a cube, (a) what is the average volume (in cubic meters) required for each iron atom and (b) what is the distance (in meters) between the centers of adjacent atoms?

Known values; mass per / volume and mass of each atom 

average volume= volume per atom. 
density*mass per atom = volume per atom 

1cm^3 / 7.87 gram * 9.27 *10^-26 kg /atom* 1000 gram / kg=
=1.178 * 10^-22 cm^3 per atom 

Convert that to mass 
1 cm^3 * (1 m / 100 cm)^3 
 average volume= 1.178 *10^-29 m^3 per  atom 

distance: 

Volume of a cube is L^3 

so L = (1.178*10^-29)^(1/3) 

Half way through the cube is distance 1/2 L. 
Second cube is 1/2 L 
So distance between the center of 2 cubes = L 

=2.28 *10^-10 m 

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

The answer is trial 3.