Physics, 12.03.2020 00:37 antonio97

A ball is thrown horizontally from a height of 17.7 m and hits the ground with a speed that is 3.00 times its initial speed. What is the speed in the vertical direction just before the ball hits the ground

Answers: 2

Show answers

Answers

Answer from: brandiwingard

19.76 m/s

Explanation:

Let v be the speed just before the ball hits the ground. The v/3 is the initial speed. When the ball falls to the ground its potential energy is converted to kinetic energy: $E_p + E_{k0} = E_k$ mgh + mv_0^2/2 = mv^2/2 where m is the mass and h = 17.7 is the vertical distance traveled, v_0 = v/3 is the initial velocity , and g = 9.81 m/s2 is the gravitational acceleration. We can divide both sides by m:

gh + v^2/18 = v^2/2

gh = 9v^2/18 – v^2/18 = 8v^2/18 = 4v^2/9

9.81*17.7 = 4v^2/9

v^2 = 390.68

$v = \sqrt{390.68} = 19.76m/s$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the force on the thing and the distance the force moves the thing

Another question on Physics

Physics, 22.06.2019 12:30

Consider a hydrogen atom in the ground state. what is the energy of its electron? =e= jj now consider an excited‑state hydrogen atom. what is the energy of the electron in the =5n=5 level? =e5= j

Answers: 3

Answer

Physics, 22.06.2019 15:00

What property of an object determines its inertia?

Answers: 2

Answer

Physics, 22.06.2019 19:50

An air-filled capacitor is formed from two long conducting cylindrical shells that are coaxial and have radii of 26 mm and 103 mm. the electric potential of the inner conductor with respect to the outer conductor is - 700 v (k = 1/4πε 0 = 8.99 × 109 n · m2/c2) the energy stored in a 1.0-m length of this capacitor is closest to

Answers: 1

Answer

Physics, 22.06.2019 21:30

Global climatic patterns are changing because of the melting of polar ice caps. the melting of polar ice caps is an example of the interaction between the atmosphere and cryosphere cryosphere and geosphere hydrosphere and geosphere biosphere and cryosphere

Answers: 1

Answer

You know the right answer?

A ball is thrown horizontally from a height of 17.7 m and hits the ground with a speed that is 3.00...

Questions