Physics, 04.04.2020 23:17 meganwintergirl

Mechanical advantage is how much the machine ___your force. a adds b substracts c multiplies d divides

Answers: 2

Show answers

Answers

Answer from: Quest

potential energy is directly proportional to height.

more height = more potential energy.

greatest increase in height = greatest increase in potential energy

where are the points with the greatest increase in height ?

has to be c-e or d-e .

Look at the pendulum diagram between which points does the pendulum’s potential energy increase most

Answer from: Quest

the grams of oxygen gas that can be produced is 20.6 grams of o₂

calculation

2liclo₃ → 2 licl + 3 o₂

step 1: find the moles of liclo₃

moles = mass÷ molar mass

from periodic table the molar mass of liclo₃ =6.9 +35.5 +(16 x3) =90.4 g/mol

moles=38.7 g÷90.4 g/mol=0.4281 moles

step 2: use the mole ratio to calculate the moles of o2

from equation above, liclo₃: o₂ is 2: 3

therefore the moles of o₂=0.4281 moles x3/2 =0.6422 moles

step 3: find mass of o₂

mass= moles x molar mass

from periodic table the molar mass of o₂ = 16 x2= 32 g/mol

mass=0.6422 moles x 32 g/mol = 20.6 grams of o₂

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

ice to water 1 water to vapour 2 latent heat

Another question on Physics

Physics, 21.06.2019 13:30

What if? physicists often measure the momentum of subatomic particles moving near the speed of light in units of mev/c, where c is the speed of light, and 1 mev = 1.6 ✕ 10−13 kg · m2/s2. based on this, what are the units of momentum for a high-speed subatomic particle in terms of fundamental si units?

Answers: 1

Answer

Physics, 22.06.2019 10:00

** urgent** the voltage across the primary winding is 350,000 v, and the voltage across the secondary winding is 17,500 v. if the secondary winding has 600 coils, how many coils are in the primary winding? a- 30 coilsb- 583 coilsc- 12,000 coilsd- 332,500 coils

Answers: 1

Answer

Physics, 22.06.2019 11:00

If a simple machine reduces the strength of a force, what must be increased?

Answers: 3

Answer

Physics, 22.06.2019 12:30

Write a full page that sumerizes thermodynamics it’s from the website visionlearnig

Answers: 1

Answer

You know the right answer?

Mechanical advantage is how much the machine ___your force. a adds b substracts c multiplies d divid...