Physics, 07.04.2020 06:08 makaylacroy02

How do you solve work and power problems

Answers: 3

Show answers

Answers

You always remember these rules . . . you dream them at night, you use them to solve your homework problems, you recite them to yourself on your way into a test, you use them to solve the test problems, and you never forget them:

1). The amount of work done is (Force) times (distance the force acts).

2). Work is energy. The amount of energy never changes. There's no way to create it, and there's no way to destroy it. Energy never just appears or disappears. If suddenly there's more energy, it came from somewhere. If suddenly there's less energy, it went somewhere. If you put some energy into a container that energy can't penetrate, then the amount of energy inside the container never changes.

3). Work is energy. So you can use energy to do work, and you can do work to provide energy for something.

4). Power is how much work is done in one second, or how much energy moves to a different place in one second.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

no. bullets are macro objects. wave nature is for light waves, extremely tiny particles. if a light particle was the size of your finger, the bullet would be the size of the universe. so basically, that huge difference in size makes the wave nature of matter insignificant.

Another question on Physics

Physics, 21.06.2019 16:50

Identify the arrows that show the correct direction of heat transfer. 66°f 112°f 98°f

Answers: 2

Answer

Physics, 22.06.2019 09:10

The air that we breath is made mostly of which gaseous molecule

Answers: 1

Answer

Physics, 22.06.2019 11:00

I'm thinking it's 2 you are asked to explain the earth's magnetic field. which is the best reply? 1. the earth's magnetic south is similar to the north pole of a magnet. 2. the earth's core has a strong magnetic charge similar to the south pole of a magnet. 3. the earth's geomagnetic south is similar to the south pole of a magnet. 4. the earth's magnetic charge is not centered at either pole; it varies based on location.

Answers: 1

Answer

Physics, 22.06.2019 19:00

The direction of the current in an alternating current circuit remains constant. is direct. changes repeatedly. changes randomly.

Answers: 1

Answer

You know the right answer?

How do you solve work and power problems...

Questions