Physics, 07.04.2020 20:10 nautiannaharper59901

In 2 minutes, a ski lift raises four skiers at a constant speed to a height of 123 m. The average mass of each skier is 71 kg. What is the average power provided by the tension in the cable pulling the lift

Answers: 1

Show answers

Answers

Answer from: olson1312

The average power provided by the tension in the cable pulling the lift is = 714 W

Explanation:

Given data

Mass = 71 kg

Change in height = 123 m

When the lift moves in upward direction then in that case kinetic energy is constant & only potential energy changes.

Change in potential energy Δ PE = m g ( h_f - h _ i )

Δ PE = 71 × 9.81 × 123

Δ PE = 85670.73 J

Time = 2 min = 120 sec

So average power is given by

$P_{avg} = \frac{Change \ in \ potential \ energy}{Time}$

$P_{avg} = \frac{85670.73}{120}$

$P_{avg} = 714 \ W$

Therefore the average power provided by the tension in the cable pulling the lift is = 714 W

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

volts times amps 6 x 0.5 3w

Another question on Physics

Physics, 21.06.2019 21:20

Jason is a body builder. despite being more fit, he weighs more than his brother ryan, who is the same height. which is a possible reason? a. jason has more muscle mass than ryan does. b. jason has more body fat than ryan does. c. jason has more muscle mass and body fat than ryan does d. jason has less body fat than ryan does.

Answers: 1

Answer

Physics, 22.06.2019 10:00

Awater-filled u-tube manometer is used to measure the pressure inside a tank that contains air. the water level in the u-tube on the side that connects to the tank is 5 ft above the base of the tank. the water level in the other side of the u-tube (which is open to the atmosphere) is 2 ft above the base. determine the pressure within the tank.

Answers: 2

Answer

Physics, 22.06.2019 11:00

How do we measure or think of speed in the united states?

Answers: 1

Answer

Physics, 22.06.2019 20:30

Atypical jetliner lands at a speed of 146 mi/h and decelerates at the rate of (10.4 mi/h)/s. if the jetliner travels at a constant speed of 146 mi/h for 1.5 s after landing before applying the brakes, what is the total displacement of the jetliner between touchdown on the runway and coming to rest?

Answers: 2

Answer

You know the right answer?

In 2 minutes, a ski lift raises four skiers at a constant speed to a height of 123 m. The average ma...

Questions