1. A 500-g block is placed on a level, frictionless surface and attached to an ideal spring. At t = 0 the block moves through the equilibrium position with speed vo in the –x direction, as shown below. At t =  sec, the block reaches its maximum displacement of 40 cm to the left of equilibrium. a. Determine the value of each of the following quantities. Show all work. • period: • spring constant: b. Using x(t) = A cos(t + o) as the solution to the differential equation of motion: i. Determine the form of the function v(t) that represents the velocity of the block. ii. Evaluate all constant parameters (A, , and o) so as to completely describe both the position and velocity of the block as functions of time. c. Consider the following statement about the situation described above. "It takes the first  seconds for the block to travel 40 cm, so the initial speed vo can be found by dividing 40 cm by  seconds." Do you agree or disagree with this statement? If so, explain why you agree. If not, explain why you disagree and calculate the initial speed vo of the block.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o