Physics, 23.04.2020 17:56 Victoriag2626

When a 5 kilogram mass is
raised vertically
2 meters from the ground, what is its gain in potential energy?

Answers: 2

Show answers

Answers

If a 5-kilogram mass is raised vertically 2 meters from the surface of the Earth, its gain in potential energy is approximately 1) 0 J 2) 10 J 3) 20 J 4) 100 J 43.

Explanation:

Answer from: Quest

potential energy is directly proportional to height.

more height = more potential energy.

greatest increase in height = greatest increase in potential energy

where are the points with the greatest increase in height ?

has to be c-e or d-e .

Look at the pendulum diagram between which points does the pendulum’s potential energy increase most

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 23:30

Awoman stands a distance d from a loud motor that emits sound uniformly in all directions. the sound intensity at her position is an uncomfortable 2.0×10-3 w/m2. at a distance 2.6 times as far from the motor, what are (a) the sound intensity and (b) the sound intensity level relative to the threshold of hearing?

Answers: 1

Answer

Physics, 22.06.2019 05:20

Alfred pushes on a heavy box, but cannot move it. the box has a lot of inertia motion friction gravity

Answers: 1

Answer

Physics, 22.06.2019 09:00

Infrared rays have a shorter wavelength than question 11 options: x-rays. ultraviolet rays. radio waves. gamma rays.

Answers: 1

Answer

Physics, 22.06.2019 10:00

In a heat engine if 1000 j of heat enters the system the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2000 j? 1. write the equation 2.list out your known variables 3.plug the numbers into the equations 4.solve 5.write your solution statement that includes initial energy and final

Answers: 3

Answer

You know the right answer?

When a 5 kilogram mass is
raised vertically
2 meters from the ground, what is its gain i...

Questions