Which phenomenon state that electricity affect magnetic field A. Self-inductance
B. Mutual inductance

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Um idk im just doing this for points so just ask google or something

All these statements are related to drake's equation. it is a probabilistic equation that shows an aproximate number of civilizations in our galaxy that we can communicate with. all the numbers that are inserted into equation are not precisely known so the result varies from 1000 to 100,000,000. the equations was not created to calculate exact number of extraterrestrial civilizations but to increase scientific knowledge how to find them.the equation is: where: n=  represents the number of civilizations in our galaxy that we could in principle communicate with today.  the average rate of  star formation  in  our galaxy  the fraction of those stars that have  planets  represents the number of planets in the galaxy that are in principle capable of having surface liquid water and life.  essentially represents the probability that life eventually arises on a habitable planet.  represents the number of life-bearing planets in the galaxy.  epresents the total number of planets on which intelligent beings have evolved and developed a communicating civilization at some time in the galaxy's history.    essentially represents the probability that on a planet with life, some organisms will eventually evolve to the point where they can build radio telescopes.    is a factor that depends on how long civilizations that reach our level of technology are able to survive.