Physics, 09.07.2020 02:01 SketchWasTaken

A 2.5-kg object falls vertically downward in a viscous medium at a constant speed of 2.5 m/s. How much work is done by the force the viscous medium exerts on the object as it falls 80 cm?

Answers: 3

Show answers

Answers

Answer from: lizzyhearts

The workdone is $W_v = - 20 \ J$

Explanation:

From the question we are told that

The mass of the object is $m = 2.5 \ kg$

The speed of fall is $v = 2.5 \ m/s$

The depth of fall is $d = 80\ cm = 0.8 \ m$

Generally according to the work energy theorem

$W = \frac{1}{2} mv_2^2 - \frac{1}{2} mv_1^2$

Now here given the that the velocity is constant i.e v_1 = v_2 = v then

We have that

$W = \frac{1}{2} mv^2 - \frac{1}{2} mv^2 = 0 \ J$

So in terms of workdone by the potential energy of the object and that of the viscous liquid we have

W = W_v - W_p

Where W_v is workdone by viscous liquid

W_p is the workdone by the object which is mathematically represented as

W_p = mgd

0 = W_v + mgd

=> W_v = - m * g * d

substituting values

W_v = - (2.5 * 9.8 * 0.8)

$W_v = - 20 \ J$

Answer from: Quest

answer: d. a cme increases the amount of energy in the solar wind

explanation:

coronal mass ejections, also called cmes, are large clouds of plasma and magnetic field that erupt from the sun. only when the cloud is aimed at earth will the cme hit earth and therefore cause impacts. high-speed solar wind streams come from areas on the sun known as coronal holes.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 03:30

Astudent is working in the lab to determine how time affect impulse the student keeps the force the same in each row but changes impact the time some data is shown witch trial has the greatest a student is working in the lab to determine how time affect impulse the student keeps the fours the same in each row but change is the impact time some data shown witch trial has the greatest impulse

Answers: 3

Answer

Physics, 22.06.2019 09:30

This is important. 1. which of the following is an si base unit for measuring length? (2 points) inch gram meter mole 2. which of the following units for distance is an si unit? (2 points) centimeter foot inch yard 3. which of the following tools should a scientist use to measure an object in meters? (2 points) electronic balance pan balance tape measure thermometer

Answers: 2

Answer

Physics, 22.06.2019 12:10

Two forces produce equal torques on a door about the door hinge. the first force is applied at the midpoint of the door; the second force is applied at the doorknob. both forces are applied perpendicular to the door. which force has a greater magnitude?

Answers: 2

Answer

Physics, 22.06.2019 12:30

Which levels of government establish and implement educational requirements for minors

Answers: 1

Answer

You know the right answer?

A 2.5-kg object falls vertically downward in a viscous medium at a constant speed of 2.5 m/s. How mu...

Questions