Physics, 18.07.2020 09:01 cecilialopez7362

Why is it, if you were on a train, moving at the speed of light, and you threw a ball into the air, it would fall back into your hand, instead of hitting you? please give a detailed answer!

Answers: 2

Show answers

Answers

According to Newton's first law of motion, all bodies will remain in a state of rest or continue in uniform motion unless acted on by external forces such that the ball will catch up to fall directly in the palm of the hand from where it is released

Explanation:

Given that the ball was already moving along in the train traveling at the speed of light, the horizontal speed of the ball before being released was that of the speed of light such as all objects within the train are traveling with the same speed, they all act as if they are stationary with respect to one another

When the ball is therefore released into the air, it falls back to the point from where it was released which is directly in the palm of the hand.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Amplify and switch electrical power and electronic signals

Another question on Physics

Physics, 22.06.2019 16:30

Atank has a shape of a cone with a radius at the top of 2 m and a height of 5 m. the tank also has a 1 m spout at the top of the tank. the tank is filled with water up to a height of 2 m. find the work needed to pump all the water out the top of the spout. (use 9.8 m/s2 for g and the fact that the density of water is 1000 kg/m3.)

Answers: 1

Answer

Physics, 22.06.2019 22:00

The pilot of a helicopter hovers at an altitude of 1200 feet over a park. the angle of depression to the base of a statue is 17 degrees. the angle of depression to the nearest park exit, in line with the statue, is 14 degrees. to the nearest foot, what is the distance from the statue to the exit?

Answers: 1

Answer

Physics, 23.06.2019 04:10

The release of energy by the nucleus of atom as a result of nuclear fission is radiant energy true false

Answers: 2

Answer

Physics, 23.06.2019 07:20

An object that weighs 75n is pulled on a horizontal surface by a horizontal pull of 50 n to the right. the friction force on this object is 30 n to the left. what is the acceleration of the object?

Answers: 1

Answer

You know the right answer?

Why is it, if you were on a train, moving at the speed of light, and you threw a ball into the air,...

Questions