a nailcontains trillions of electrons. given that electrons repel from each other why do not then fly out of the nails?

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Follow me on ig 919nappy

Depending on how the continental plates move it can cause a continental scale shift.

Initial velocity,  u = 4.9 m/sfinal velocity = v m/sinitial height,  h₁ =  245 m    final height, h₂ = 0a = -9.8  m/s²time taken = t secondss = ut + 0.5at²⇒  (h₂-h₁) = ut + 0.5at²⇒  0-245 = 4.9t + 0.5×(-9.8)×t²⇒ -245 = 4.9t - 4.9t²⇒ 4.9t² -4.9t -245 =0solving it, we get   t = 7.59sv  = u +  at = 4.9 -9.8×7.59 = 4.9 - 74.38 = -69.48 m/svelocity is  69.48 m/s downward