Physics, 01.09.2020 21:01 zjthomas846

Three remote control cars are identical size and weight. The motors installed in the three cars are 100 watts, 150 watts and 200 watts respectively. Describe what will be true about the maximum speed of each car? Explain.

Answers: 1

Show answers

Answers

Answer from: joel4676

The true statement about the maximum speed of each car will be that the power of each car directly proportional to the speed of each car.

Explanation:

Given that,

Power of first car = 100 watt

Power of second car = 150 watt

Power of third car = 200 watt

We know that,

Power :

The power is directly proportional to the cube of speed.

In mathematically,

$P\propto v^3$

Where, P = power

v = speed

If the power is increased then the speed will be increase.

We need to find the maximum speed of car

According to question,

The power of car is maximum so the speed of car will be maximum.

For first car,

The power of first car is 100 watt.

So, the speed of first car will be 1000000 m/s.

For second car,

The power of second car is 150 watt.

So, the speed of second car will be 3375000 m/s.

For third car,

The power of third car is 200 watt.

So, the speed of first car will be 8000000 m/s.

Hence, The true statement about the maximum speed of each car will be that the power of each car directly proportional to the cube of speed of each car.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

The earths atmosphere is made up of nitrogen and oxygensolids turning into gases is called sublimation.

Another question on Physics

Physics, 22.06.2019 09:00

When a bicycle coasts uphill, it moves slower and slower as it climbs. why? a. its kinetic energy is transforming into heat energy. b. its potential energy is transforming into kinetic energy. c. its kinetic energy is transforming into potential energy and heat energy. d. its potential energy is transforming into kinetic energy and heat energy.

Answers: 1

Answer

Physics, 22.06.2019 11:00

How do we measure or think of speed in the united states?

Answers: 1

Answer

Physics, 22.06.2019 14:40

14. a body is projected with velocity vi from a.at the same time another body is projectedvertically upwards from point b withvelocity v2 lies vertically below the highestpoint. both the bodies collide thenv2÷v1is

Answers: 1

Answer

Physics, 23.06.2019 01:40

When you see distant streetlights through smog, they look dimmer and redder than they do normally. but when you see the same streetlights through fog or falling snow, they look dimmer but not redder. use your knowledge of the interstellar medium to discuss the relative sizes of the particles in smog, fog, and snowstorms compared to the wavelength of light.

Answers: 3

Answer

You know the right answer?

Three remote control cars are identical size and weight. The motors installed in the three cars are...

Questions