Physics, 04.02.2020 01:01 victoriamscott460

Which of the following describes a conductor? a. a rubber shoe sole with electrons stuck to the bottom. b. electrons moving freely through a copper wire. c. a balloon with a small region of negatively charged electrons. d. a rubber coating preventing electrons from moving from a radio cord to your hand.

Answers: 1

Show answers

Answers

Answer from: estherstlouis7812

B. Electrons moving freely through a copper wire.

Explanation:

- A conductor is a material which can conduct an electric current, which means it is a material where electrons are free to move through

- An insulator is a material in which electrons are not free to move, so they stuck at one place, and no electric current can pass through it

Let's now analyze each option:

A. a rubber shoe sole with electrons stuck to the bottom. --> this is an insulator, because the electrons are stuck at one place

B. Electrons moving freely through a copper wire. --> this is a conductor, since electrons are moving freely through the wire, so an electrical current is produced

C. a balloon with a small region of negatively charged electrons. --> this is still an insulator, since the electrons are stuck in one region

D. A rubber coating preventing electrons from moving from a radio cord to your hand. --> this is an insulator, since the rubber coating is preventing electrons from moving

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Depending on how the continental plates move it can cause a continental scale shift.

Another question on Physics

Physics, 21.06.2019 23:00

Asubmarine has a "crush depth" (that is, the depth at which water pressure will crush the submarine) of 250 m. what is the approximate pressure (water plus atmospheric) at this depth? (recall that the density of seawater is 1025 kg/m3, g = 9.81 m/s2, and 1 kg/(ms2) = 1 pa = 9.8692 10-6 atm.) a. 34.8 atm b. 24.8 atm c. 25.8 atm d. 7.8 atm

Answers: 2

Answer

Physics, 22.06.2019 15:50

Select all the correct answers. which changes will increase the rate of reaction during combustion? decreasing the area of contact between the reactants adding more oxygen to the reaction removing heat from the reaction changing the reactants from solid form to powdered form lowering the exposure of the reactants to air

Answers: 3

Answer

Physics, 22.06.2019 18:00

Can you receive a shock severe enough to prevent you from releasing the wire from an ordinary outlet with dry hands? a. no b. yes explain

Answers: 1

Answer

Physics, 22.06.2019 18:00

Wind and moving water provide energy. question 1 options: chemical mechanical thermal none of the above

Answers: 1

Answer

You know the right answer?

Which of the following describes a conductor? a. a rubber shoe sole with electrons stuck to the bot...