Physics, 20.11.2020 01:00 friendsalwaysbae

A dog barks to alert his owner. What is the medium for the sound waves produced by the dog barking?

Answers: 2

Show answers

Answers

Answer from: darianhaynes

The medium for the sound waves produced by the dog barking is the air

Explanation:

Sound waves are a form of mechanical waves such that it moves from one point to another by the vibration, back and forth of the medium particles from one layer to the next, thereby the particles of the medium remain in the same location and only the wave energy is propagated

The medium which has particles that vibrate back and forth in order to transmit the barking of the dog is the air.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

what is the speed of a softball that travels 20m in 2secs

speed = 20/2 = 10 m/s

Another question on Physics

Physics, 22.06.2019 02:00

Free runners jump long distances and land on the ground or a wall. how do they apply newton’s second law to lessen the force of impact?

Answers: 3

Answer

Physics, 22.06.2019 05:30

Iwill give 30 points to whoever answers ! what is the formula for actual mechanical advantage and ideal mechanical advantage?

Answers: 1

Answer

Physics, 22.06.2019 06:00

Why don't you see your reflection in water with waves or repples

Answers: 1

Answer

Physics, 22.06.2019 18:00

Atank is filled with an ideal gas at 400 k and pressure of 1.00 atm . part a the tank is heated until the pressure of the gas in the tank doubles. what is the temperature of the gas?