Physics, 10.12.2020 23:10 finesser16

Can anyone please help me!!?

Answers: 1

Show answers

Answers

Answer from: Quest

This is what i found on google “what happens to the bond angle when you add or remove an electron domain? the bond angle decreases as you add domains 5. can you force the atoms into new configurations by pushing atoms around? note: we can think of a bond or a lone pair of electrons as a “domain” of electrons.” i hope this you

Answer from: Quest

c because the action was the roller coaster reaches bottom of hill (action) reaction would be blood tends to drain away from head

hope this !

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

d₁ = displacement of tern from arctic to antarctic = 11000 miles

d₂ = displacement of tern from antarctic to arctic = - 11000 miles

d = total displacement for the journey

total displacement for the journey is given as

d = d₁ + d₂

d = 11000 + (-11000)

d = 0 miles

t₁ = time of travel from arctic to antarctic = 3 months = 3 x 30 days = 90 days

t₂ = time of travel from antarctic to arctic = 3 months = 3 x 30 days = 90 days

t = total time of travel

total time of travel is given as

t = t₁ + t₂

t = 90 + 90

t = 180 days

average velocity is given as

average velocity = total displacement/ total time

v = d/t

v = 0/180

v = 0 miles/day

Another question on Physics

Physics, 21.06.2019 22:50

Moon effect. some people believe that the moon controls their activities. if the moon moves from being directly on the opposite side of earth from you to being directly overhead, by what percentage does (a) the moon's gravitational pull on you increase and (b) your weight (as measured on a scale) decrease? assume that the earth–moon (center-to-center) distance is 3.82 × 10^8 m, earth's radius is 6.37 × 10^6 m, moon's mass is 7.36 × 10^22 kg, and earth's mass is 5.98 × 10^24 kg.

Answers: 2

Answer

Physics, 21.06.2019 22:50

As a car drives with its tires rolling freely without any slippage, the type of friction acting between the tires and the road is 100) a) static friction. b) kinetic friction. c) a combination of static and kinetic friction. d) neither static nor kinetic friction, but some other type of friction. e) it is impossible to tell what type of friction acts in this situation.

Answers: 1

Answer

Physics, 22.06.2019 05:00

Which of the following is the result of the nuclear weak force? the instability of large nuclei the repelling force between positively charged protons the structure of the atom certain types of nuclear decay

Answers: 2

Answer

Physics, 22.06.2019 17:30