Physics, 18.01.2021 22:40 Dajuan2x

Three charges, each separated by 100 m from adjacent charges, are located along a horizontal line: a -3.00 C charge on the left, a 2.00 C charge in the middle, and a 1.00 C charge on the right. What is the resultant force on the 1.00 C charge due to the other two

Answers: 3

Show answers

Answers

Answer from: zingchristina

F= 11.25*10⁵ N to the right.

Explanation:

Assuming that the three charges can be treated like point charges, they must obey Coulomb's Law.Due to the linearity of this Law, we can use superposition in order to find the resultant force on the 1.00 C charge due to the other two.First, we find the force that the -3.00 C charge (located 200 m to the left) exerts on the 1.00 C, as follows:

$F_{13} = \frac{K*q_{1}*q_{2}}{r_{13} ^{2} } = \frac{9e9*(-3.00C)(1.00C)}{(200m)^{2}} = -6.75e5 N (1)$

Then, in the same way, we can find the force that the 2.00 C exerts on the 1.00 C charge, located 100 m away to the left:

$F_{23} = \frac{K*q_{3}*q_{2}}{r_{23} ^{2} } = \frac{9e9*(2.00C)(1.00C)}{(100m)^{2}} = 18e5 N (2)$

Since both vectors are on the same line, their sum is directly the algebraic sum, as follows:F₃ = F₁₃ + F₂₃ = -6.75*10⁵ N + 18.00*10⁵ N = 11.25*10⁵ N to the right, assuming this direction as positive.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

i believe the answer is a hope it and is correct

Another question on Physics

Physics, 22.06.2019 05:00

Which car has the most kinetic energy? a. a car of mass 1000 kg with a speed of 3 m/s b. a car of mass 2000 kg with speed 7 m/s c. a car of mass 1000 kg with speed 7 m/s d. a car of mass 2000 kg with speed 3 m/s

Answers: 1

Answer

Physics, 22.06.2019 06:30

If an atom contains 11 protons in its nucleus, predict the element with the atomic number and electronic configuration. will the number of electrons remain the same during the chemical reaction in such an atom? explain.

Answers: 3

Answer

Physics, 22.06.2019 14:00

Acar travels in reverse. it covers 150 meters in 12 seconds what is the velocity of the car what is the speed of the car

Answers: 1

Answer

Physics, 23.06.2019 00:00

You are a researcher for a golf club manufacturer. you are given two identical looking cubes of a metal alloy. you are informed that they are made of the exact same material, but one is crystalline, whereas the other is amorphous. it is your job to determine which one is amorphous this one is more stress-resistant and is useful in reinforcing golf clubs. which of the following is the best way to determine which is which? a. determine the density of each cube. the more dense one is the amorphous solid. b. melt both cubes and look for a broader range of melting temperatures. the one that melts over a broader range of temperatures is the amorphous solid. c. determine the density of each cube. the less dense cube is the amorphous solid. d. melt both cubes and measure the range of melting temperatures. the one that melts over a narrower range of temperatures is the amorphous solid.

Answers: 1

Answer

You know the right answer?

Three charges, each separated by 100 m from adjacent charges, are located along a horizontal line: a...

Questions