4. Pendulum has a m 1.0 kg, L 2.0 m, g 9.8 m/s?, and to -40 degrees. What is the maximum velocity of this pendulum? Show your work. (Hint: The exact height of the
pendulum is now 0.468 m.)

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

He sandals were out in the sun so the got hotter. which is why her feet felt hot.

At maximum height, kinetic energy is converted in potential energy  formula: at max height, ke = ½ * 0.27kg * (16m/s) ² = 34.56 j  so the remaining pe = (41.70 – 34.56)= 7.14 j = 0.27 kg * 9.8m/s² * h  = (9.8/7.14 * 0.27)so max height h = 5.08 or 5 m