VP 3.12.1 Part APart complete A cyclist going around a circular track at 10.0 m/s has a centripetal acceleration of 5.00 m/s2. What is the radius of the curve? Express your answer with the appropriate units. R = 20.0 m Previous Answers Correct VP 3.12.2 Part B A race car is moving at 40.0 m/s around a circular racetrack of radius 265 m. Calculate the period of the motion. Express your answer in seconds. T = nothing s Request Answer Part C Calculate the car’s centripetal acceleration.

A) r = 20.0 m

B) T = 41.6 s

C) = 6.1 m/s²

Explanation:

A)

The centripetal acceleration is the one that explains that even though the cyclist is moving at a constant speed, his velocity is changing the direction all the time, keeping him around a circle.This acceleration can be expressed as follows:

       

Solving for r:

       

B)

We can apply the definition of linear velocity, remembering that the period is the time needed to complete an entire circle (T).The arc around a circumference (the distance traveled) , is just 2*π*r, so applying the definition of linear velocity, we can write the following expression:

       

Solving  for T:

       

C)

The centripetal acceleration of the car from B) can be found as follows:

       

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Ithink the answer would be a