Physics, 01.04.2021 23:00 braegan64

Can someone please explain how to solve this?

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the answer is b, have negligible mass

Answer from: Quest

Examples: mental health problems cardiovascular disease obesity and other eating disordersmenstrual problems skin and hair problems

Answer from: Quest

Answer: a charge of -1.0 × 10⁻⁴ c must be placed at x = 26 m.the sign of the charge will be the same sign as the -4.0 µc charge.======electricstatic force between two point charges is given by $f = \dfrac{kq_1q_2}{r^2}$ where k is coulomb's constant, 8.99×10⁹ n·m²/c², q₁ and q₂ are the point charges, and r is the distance between the two point charges.assign positive to q₁let q₁ = 6.0 µc, q₂ = -4.0 µc, q₀ represent the charge at the origin, and q₃ represent this new charge to place.the charge at the origin q₀ would experience the following force f₀₁ from q₁, with r = 6.0 m (note that 1 µc = 10⁻⁶ c) $f_{01} = \dfrac{kq_0q_1}{(\text{6.0 m})^2}$ the force from q₂ $f_{02} = \dfrac{kq_0q_2}{(\text{15 m})^2}$ the force from q₃ $f_{03} = \dfrac{kq_0q_1}{(\text{26 m})^2}$ the net force on the origin charge, q₀, has to be zero for no electrostatic forcehaving an equation where k and q₀ can be divided out of the equation will allow us to solve for q₃ $\begin{aligned} f_{net} & = 0\\ f_{01} + f_{02} + f_{03} & = 0 \\ \dfrac{kq_0q_1}{(\text{6.0 m})^2} + \dfrac{kq_0q_2}{(\text{15 m})^2} + \dfrac{kq_0q_3}{(\text{26 m})^2} & = 0 \\ kq_0 \left( \dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2} + \dfrac{q_3}{(\text{26 m})^2}\right) & = 0 \\ \dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2} + \dfrac{q_3}{(\text{26 m})^2} & = 0 \end{aligned}$ isolating: $\begin{aligned} \dfrac{q_3}{(\text{26 m})^2} & = -\dfrac{q_1}{(\text{6.0 m})^2} - \dfrac{q_2}{(\text{15 m})^2} \\ q_3 & = -(\text{26 m})^2\left(\dfrac{q_1}{(\text{6.0 m})^2} + \dfrac{q_2}{(\text{15 m})^2}\right) \\ q_3 & = -(\text{26 m})^2\left(\dfrac{6.0\times10^{-6} \text{ c}}{(\text{6.0 m})^2} + \dfrac{-4.0\times10^{-6} \text{ c}}{(\text{15 m})^2}\right) \\ q_3 & = -1.0064888 \times 10^{-4}\text{ c} \\ q_3 & = -1.0\times 10^{-4}\text{ c} \end{aligned}$ a charge of -1.0 × 10⁻⁴ c must be placed at x = 26 m.the sign of the charge will be the same as the -4.0 µc charge

Another question on Physics

Physics, 22.06.2019 12:30

What is the power rating of the lightbulb if 3.0 a flow through it when connected to a 15 v battery

Answers: 1

Answer

Physics, 22.06.2019 17:00

Simon is writing a story about an astronaut whose spacecraft has been boarded by space pirates. the astronaut has her lucky penny in her hand behind her back as the space pirates break into the control room. she has just locked the controls so that the ship is accelerating in the direction of the control room’s ceiling. simon wants the astronaut to use the penny to hit a button on the control panel to turn off the lights and escape. the button is located a short distance behind and below the astronaut’s hands. how should simon use the theory of relativity to describe what the astronaut must do in order to hit the button?

Answers: 1

Answer

Physics, 22.06.2019 20:50

Suppose that a mass of 2 kg is attached a spring whose spring constant is 50. the system is damped such that b = 12 . the mass is set in motion with an initial velocity of -8 m/s at a position 0 meters from equilibrium. set up and solve a differential equation that models this motion. write your solution in the form a cos ( ω t − α ) where α is a positive number. use your solution to fill in the information below: what is the amplitude of the motion? what is the value of ω ? what is the phase shift?

Answers: 1

Answer

Physics, 23.06.2019 01:00