Achair of mass 30.0 kg is at rest on a horizontal floor. the floor is not frictionless. you push on the chair with a force of 80.0 n directed at an angle of 35.0° to the floor. what is the normal force that the floor exerts on the chair?

First make sure you draw a force diagram. You should have Fn going up, Fg going down, Ff going left and another Fn going diagonally down to the right. The angle of the diagonal Fn (we'll call it Fn2) is 35° and Fn2 itself is 80N. Fn2 can be divided into two forces: Fn2x which is horizontal, and Fn2y which is vertical. Right now we only care about Fn2y.

To solve for Fn2y we use what we're given and some trig. Drawing out the actual force of Fn2 along with Fn2x and Fn2y we can see it makes a right triangle, with 80 as the hypotenuse. We want to solve for Fn2y which is the opposite side, so Sin(35)=y/80. Fn2y= 80sin35 = 45.89N

Next we solve for Fg. To do this we use Fg= 9.8 * m. Mass = 30kg, so Fg = 9.8 * 30 = 294N.

Since the chair isn't moving up or down, we can set our equation equal to zero. The net force equation in the vertical direction will be Fn + Fn2y -Fg = 0. If we plug in what we know, we get Fn + 45.89 -294 = 0. Then solve this algebraically.

Fn +45.89 -294 = 0
Fn +45.89 = 294
Fn = 248.11 N

You'll get a more accurate answer if you don't round Fn2y when solving for it, it would be something along the lines of 45.88611 etc

The third hammer 8 pounds

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o