Physics, 18.08.2019 11:20 clemsongirl5392

3. compare the slope of the velocity-time graph to the average of all your acceleration values. are they close? what does the slope of a velocity (or speed) vs. time graph mean? explain the answer using your data. how does the value of g that you calculated compare to the accepted value of 9.80 m/s2? what is your percent error? remember that the value of g can be calculated by using g = a/sinθ and percent error can be calculated using the following equation:

Answers: 1

Show answers

Answers

The slope of a speed-time graph is the acceleration represented by the graph.

All other parts of this question refer to a lab experiment or exercise
where I was not present, but Zeesam16 was. Therefore I have no data
with which to answer the rest of the question, and hope that Zeesam can
handle it.

Answer from: Quest

with the invention of the automobile, the woman of the house could drive to the store and get groceries. women were also free to socialize more. during world war ii women were allowed to work in factories to the war effort and could drive to work or ride mass transit buses to their jobs.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 07:10

1. how much energy is needed to raise the temperature of 40.0 g of argon from 25c to 40c? the specific heat capacity of argon is 0.520 j/(g·k) 2a. 23.0 ml of 0.100 m hcl (standard) are added from a buret to neutralize 50.0 ml of an unknown basic solution. 2b. if the oh- produced in the previous reaction came from ca(oh)2, then what is the molarity of the ca(oh)2? 3.calculate the new freezing-point of a solution when 60.5 grams of cacl2 solute is dissolved in 0.612 kg of water. 4. what is the maximum number of moles of alcl3 that can be produced from 5.0 mol al and 6.0 mol cl2? 5. a sample of oxygen gas has a volume of 150 ml when its pressure is 0.923 atm. if the pressure is increased to 0.987 atm and the temperature remains constant, what will the new volume be? 6. nitrogen gas in a closed container at a temperature of 100.0 oc and 3.0 atm is heated to 300 oc. what is the pressure of the gas at the higher temperature?

Answers: 3

Answer

Physics, 23.06.2019 01:00

What happens during the fall in september

Answers: 1

Answer

Physics, 23.06.2019 02:00

Did anyone do 1.06 lab: cloud formation i need with it i go to k12 lavcame i need to get it done quick

Answers: 2

Answer

Physics, 23.06.2019 07:00

Why does an object have a different weight o the moon than it does on earth