Check my answers !

1) a negative point charge of 2.0 × 10^–6 c experiences a force of 0.060 n from another source charge. what is the strength of the electric field, and how does its direction compare with the force?

a) 3.0 × 10^4 n/c, same

b) 3.0 × 10^4 n/c, opposite < < < <

c) 1.2 × 10^3 n/c, same

d) 1.5 × 10^4 n/c, opposite

2) two point charges of +2.50 × 10^–5 c and –2.50 × 10^–5 c are separated by 0.50 m. which of the following describes the force between them?

a) 45 n, attractive

b) 23 n, attractive

c) 90 n, attractive < < < <

d) 90 n, repulsive

3) two parallel plates have an electric potential difference of 20.0 v. if the electric field between them has a strength of 1.0 × 10^3 n/c, then how far apart are the plates?

a) 1.0 cm

b) 2.0 cm < < < < < < <

c) 10.0 cm

d) 5.0 cm

4) an electric field measured near a point charge of 3.00 × 10^–6 c has a strength of 1.50 × 10^5 n/c. how far is the point from the source charge?

a) 0.42 m

b) 0.36 m < < < < <

c) 0.095 m

d) 0.30 m

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o