Which uses the refractive properties of light to separate it into its different wavelengths?
a.
white light from the surface of a mirror
b.
colored light as it travels from a solid medium to a liquid medium
c.
visible light as it passes through a lens
d.
sunlight through droplets of water in the atmosphere

A). No.  A mirror doesn't separate light into its different wavelengths.

B). No.  Light doesn't separate into its different wavelengths when it
goes, say, from glass into water.

C). No.  When light goes through your glasses, it doesn't separate
into its different wavelengths.

D). Yes !  When sunlight shines into droplets of water in the atmosphere,
it comes out separated into its different wavelengths.  When we see that
happening in the air in front of us, we call it a "rainbow".

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o