Physics, 23.04.2021 16:30 ajam71501

Describe the difference between potential and kinetic energy

Answers: 3

Show answers

Answers

Energy stored in an object due to its position is Potential Energy. Energy that a moving object has due to its motion is Kinetic Energy.

So the difference is that potential energy doesn't move while kinetic energy is moving

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

air exerts forces on falling objects near earth’s surface.

explanation:

the term 'free falls' refer to object that are falling towards the earth, in a situation in which gravity is the only force acting on the object.

for an object in free fall, the acceleration is constant (g, the gravitational acceleration), and so the velocity of the object constantly increases.

for objects near earth's surface, there is always another force acting on the object: the resistance due to the air. this force is opposed to the direction of fall of the object, and it is proportional to the velocity of the object, so as the object falls down, this force increases up to a point when it balances the force of gravity, and the object continues its motion at constant velocity (called terminal velocity). since in this case gravity is not the only force acting on the object, we are not in a situation of free fall.

Another question on Physics

Physics, 21.06.2019 12:30

Acar is going 5m/s around a bend with a radius of 10m/s why is the accelerant?

Answers: 1

Answer

Physics, 22.06.2019 01:40

Lin yao looks at the back of a spoon. how should she describe her reflection? upside down and smaller upside down and larger right-side up and smaller right-side up and larger

Answers: 1

Answer

Physics, 22.06.2019 11:30

In order of decreasing light-transmitting capabilities of materials, which is the correct sequence? a. transparent -> translucent -> opaque b. opaque -> transparent -> translucent c. opaque -> translucent -> transparent d. translucent -> transparent -> opaque

Answers: 1

Answer

Physics, 22.06.2019 12:10

Point charges q1 = 51 µc and q2 = −27 µc are placed 1.0 m apart, with q2 on the right. what is the force (in n) on a third charge q3 = 19 µc placed midway between q1 and q2? (assume the positive direction is to the right. indicate the direction with the sign of your answer.)

Answers: 3

Answer

You know the right answer?

Describe the difference between potential and kinetic energy...

Questions