Two identical charges of 10 Coulombs are .1 meter away from each other. Calculate the Electric Force on the objects.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

B) raising the temperature and reducing the volume of the gas.|-/ 

Answer

the order for strong to weak forces such as

strong nuclear force → electromegnetic force → weak nuclear force → gravitational force

explanation

the fundamental forces are those forces that act between to objects or element to make interactions. there are four types of fundamental forces such as strong and weak nuclear forces (due to protons and electrons), electromagnetic force (due to the motion of electrons) and gravitational force (due to orbital movement of the planet). if these forces are arranged on the basis of their maximum strength then the order is

strong nuclear force → electromegnetic force → weak nuclear force → gravitational force