.It takes time 8 min 20 seconds for light to reach from sun to the earth surface. If speed of light is taken to be 3times10^(5)km/h. Find the distance of the sun from the earth in SI system.

Energy transformations are processes that convert energy from one type (e.g., kinetic, gravitational potential, chemical energy) into another. any type of energy use must involve some sort of energy transformation.energy must obey the laws of thermodynamics.thermodynamics is the study of how energy changes from one type to another. the laws of thermodynamics apply to energy and energy conversions.the first law of thermodynamics: main articleenergy cannot be created or destroyed (which is called the conservation of energy); however, it can be transformed from one type into another. in fact, every useful process transforms energy from one form to another. there are many different forms or types of energy. some examples of everyday energy transformations are: scenario energy conversions involvedrubbing hands together to make them warm kinetic energy to thermal energyusing a battery-powered flashlight chemical energy to electrical energy (in the battery)electrical energy to radiant energy (in the bulb)an object speeding up as it falls gravitational potential energy to kinetic energythe second law of thermodynamics: main articlesome forms of energy are more useful than others. using energy always makes it less useful, even though no energy is actually destroyed.kinetic energy and electricity are the most useful forms. these are "high-quality" because they can be transformed almost completely into any other type of energy. electricity, for example, can be easily used to generate heat (thermal energy) or light (radiant energy), break chemical bonds (chemical energy), move objects (kinetic energy), or lift objects (gravitational potential energy).the least useful form of energy is low-temperature thermal energy. it can still be converted back to a higher-quality form, but useful energy is always lost in this process. converting energy to a less-useful form and then trying to work backwards never gets 100% of the useful energy back.for example, when a car runs, the engine will become hot (thermal energy). the warmth of the engine does nothing to the car move or go faster. this wasted energy is an unavoidable by-product of converting the car's fuel (chemical energy) into movement ("high-quality" kinetic energy), however it can potentially be used for heating the cabin of the car to slightly increase overall energy efficiency. it is a challenge for all forms of power generation to minimize wasted energy and be as efficient as possible.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o