Physics, 06.10.2021 23:20 richtercatrina16

Which piece of evidence supports your answer to #10. * 1 point
Robin’s graph is nonlinear because as you increase mass, kinetic energy increases at a constant rate.
Robin’s graph is nonlinear because as you increase mass, kinetic energy increases by a larger amount.
Katelyn’s graph is nonlinear because as you increase speed, kinetic energy increases at a constant rate.
Katelyn’s graph is nonlinear because as you increase speed, kinetic energy increases by a larger amount.

Answers: 3

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

unbalanced force

explanation:

Answer from: Quest

see the picture for the vector

the magnitude of the vector by pythagorean theorem

r = √( (-10)^2 + (3)^2 ) = √109

magnitude = √109 units

the direction angle between vector and x-axis is

tan^(-1)(3/10) = 16.699

so the direction is approximately 16.7 degrees north of west

Answer from: Quest

note: the given question is incomplete.

complete question is given below.

which is an example of kinetic energy?

a. the energy stored in ethanol

b. a hockey puck sliding across the ice

c. a compressed spring

d. a ball sitting at the top of a ramp

solution: the kinetic energy is the energy posses by the virtue of the motion of the object.

in the given options, a, c and d are the example of potential energy because it is the energy posses by the virtue of the rest of the object. but option b has the kinetic energy as the object is in motion.

hence, a hockey puck sliding across the ice is the apex example of kinetic energy.

so, the option (b) a hockey puck sliding across the ice is the correct option.

Another question on Physics

Physics, 21.06.2019 16:10

Zirconium has an hcp crystal structure and a density of 6.51 g/cm3. (a) what is the volume of its unit cell in m3? (b) if the c/a ratio is 1.593, compute the values of c and a.

Answers: 3

Answer

Physics, 21.06.2019 22:30

The law of conservation of energy states that energy cannot be created or , energy can be from one substance to another. the first blank is ' destroyed ' and for the second blank is ' transferred '

Answers: 1

Answer

Physics, 22.06.2019 05:20

Alfred pushes on a heavy box, but cannot move it. the box has a lot of inertia motion friction gravity

Answers: 1

Answer

Physics, 22.06.2019 06:40

How does the kinetic energy of a charge change as the charge moves under the effect of an electric field from higher potential to lower potential? a.the kinetic energy increases.b.the kinetic energy decreases.c.the kinetic energy remains the same.d.the kinetic energy is always zero.

Answers: 1

Answer

You know the right answer?

Which piece of evidence supports your answer to #10. * 1 point
Robin’s graph is nonlinear be...

Questions