Physics, 09.12.2021 02:40 sbednarek

how do your forces change as you move your hand closer to and further from the end of the meter stick

Answers: 3

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

i believe the answer is a hope it and is correct

Answer from: Quest

the answer is ampere

the ampere is used to measure electricity. an ampere is a unit of electric current equal. a unit of measure for the flow of current in a circuit. one ampere is the amount of current flow provided when one volt of electrical pressure is applied against one ohm of resistance.

Answer from: Quest

note: the given question is incomplete.

complete question is given below.

which is an example of kinetic energy?

a. the energy stored in ethanol

b. a hockey puck sliding across the ice

c. a compressed spring

d. a ball sitting at the top of a ramp

solution: the kinetic energy is the energy posses by the virtue of the motion of the object.

in the given options, a, c and d are the example of potential energy because it is the energy posses by the virtue of the rest of the object. but option b has the kinetic energy as the object is in motion.

hence, a hockey puck sliding across the ice is the apex example of kinetic energy.

so, the option (b) a hockey puck sliding across the ice is the correct option.

Another question on Physics

Physics, 22.06.2019 05:00

He viscosities of several liquids are being compared. all the liquids are poured down a slope with equal path lengths. the liquid with the highest viscosity will

Answers: 3

Answer

Physics, 22.06.2019 13:20

This energy transformation diagram represents the energy of a skateboarder moving along a half-pipe. as she skates toward the top of the half-pipe, her original kinetic energy is converted to potential energy and friction. how much of the energy is potential?

Answers: 3

Answer

Physics, 22.06.2019 13:40

Which bonds are found inside a water molecule

Answers: 1

Answer

Physics, 22.06.2019 18:30

4. now look at the green lines you created by connecting the three boiling point data points and the three melting point data points. for each of these lines, describe any trends you see. 5. locate the elements on your periodic table that you circled in green on your graph. what term or description would you use to identify these elements with respect to the periodic table? 7. using the room temperature line (orange line) and your periodic table, make lists that identify the state of matter (gas, liquid, or solid) in which each element you plotted exists at room temperature. explain your answers.

Answers: 2

Answer

You know the right answer?

how do your forces change as you move your hand closer to and further from the end of the meter stic...

Questions