Physics, 16.07.2019 10:50 DAVISJOS00123

Astorm is moving east towards your house at an average speed of 35 km/hr. if the storm is currently 80 kilometers from your house in how much time do you expect it to arrive

Answers: 2

Show answers

Answers

The storm is moving toward you at 35km/hr. How long until it travels to 80 kilometers to your house?
Distance = velocity * time
80km = 35 km/hour * x hours Divide both sides by 35
2.29 hours = x

It will take 2.29 hours to reach your house.

Answer from: roseemariehunter12

The problem given above will be solved by using the speed formula.
Speed is defined as distance over time, that is,
Speed [S] = Distance [D] / Time [T].
In the question, the value of speed that we are given is 35 and the value of D is 80, we have to find the value of time.
S = 35
D = 80
T = ?
S = D /T = 35 = 80 / T
35T = 80
T = 80 / 35 = 2.29.
Therefore, T = 2.3 hour.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

vapour or gas assuming atmospheriv pressure

Another question on Physics

Physics, 21.06.2019 20:20

Ateam of astronauts is on a mission to land on and explore a large asteroid. in addition to collecting samples and performing experiments, one of their tasks is to demonstrate the concept of the escape speed by throwing rocks straight up at various initial speeds. with what minimum initial speed vesc will the rocks need to be thrown in order for them never to "fall" back to the asteroid? assume that the asteroid is approximately spherical, with an average density p 3.84 x108 g/m3 and volume v 2.17 x 1012 m3 recall that the universal gravitational constant is g 6.67 x 10-11 n m2/kg2

Answers: 2

Answer

Physics, 22.06.2019 09:00

When a bicycle coasts uphill, it moves slower and slower as it climbs. why? a. its kinetic energy is transforming into heat energy. b. its potential energy is transforming into kinetic energy. c. its kinetic energy is transforming into potential energy and heat energy. d. its potential energy is transforming into kinetic energy and heat energy.

Answers: 1

Answer

Physics, 22.06.2019 10:30

Agroup of students were investigating the force of gravity. they began by dropping a foam ball from a height of 3 meters into a bucket of sand. the ball hit the sand in 0.306 seconds. they dropped additional balls of approximately the same diameter, but of different masses. here is the data they collected. based on this experiment and the collected data, what would their conclusion be?

Answers: 1

Answer

Physics, 22.06.2019 11:00

If angle "a" is 25°, angle "b" is: a) equal to angle c b) less than angle c c) greater than angle c

Answers: 1

Answer

You know the right answer?

Astorm is moving east towards your house at an average speed of 35 km/hr. if the storm is currently...

Questions