A70.0-kg ice hockey goalie, originally at rest, has a 0.280-kg hockey puck slapped at him at a velocity of 45.5 m/s. suppose the goalie and the puck have an elastic collision, and the puck is reflected back in the direction from which it came. what would the final velocities of the goalie and the puck be in this case? assume that the collision is completely elastic.

mₐ vᵢₐ + mᵦ vᵢᵦ = mₐ vfₐ + mᵦ vfᵦ ==> [i and f means initial and final velocities] 

0.5 mₐ vᵢₐ² + 0.5 mᵦ vᵢᵦ² = 0.5 mₐ vfₐ² + 0.5 mᵦ vfᵦ² 

The collision is completely specified given the two initial velocities and the masses of the two objects. Combining the two equations above gives us a solution to the final velocities for an elastic collision of two objects: 

vfₐ = [(mₐ - mᵦ) vᵢₐ + 2 mᵦ vᵢᵦ]/[mₐ + mᵦ] 

vfᵦ = [2 mₐ vᵢₐ − (mₐ - mᵦ) vᵢᵦ]/[mₐ + mᵦ] 

substituting the values 

mₐ = 70 kg 
mᵦ = 0.280 kg 
vᵢₐ = 0 m/s 
vᵢᵦ = 45.5 m/s 

=> vfₐ = [(70 - 0.280) 0 + 2(0.280) 45.5]/[70 + 0.28] 

= 1.35 m/s >(in the original direction of the puck) 

and 

=> vfᵦ = [0 − (70 - 0.280) 45.5]/[ 70 + 0.28] = -45.14 m/s (opposite direction) 

 

 

Final speeds are therefore:

goalie = 1.35 m/s

puck = 45.14 m/s (opposite direction)

If an object is moving or in motion

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o