Fan electron fell to a lower orbit or energy level, energy would be
a. created.
b. emitted.
c. absorbed.
d. transferred.

How interesting that you described it as a "fall" to a
"lower energy" level.  You picked up that description
from hearing it used somewhere before. 

It's an accurate description, and it's a big hint to the answer.

When an object falls from a higher to a lower place,
it gives up gravitational potential energy, and then
it has less of it.  If it wants to return to the height
where it was before, somebody has to come along
and do work on it to lift it, and give it back the energy
it needs to be up at that height.
 
Same with your electron.  The farther it is from the
nucleus, the more potential energy it has ... only
it's electrical, not gravitational. 
If the electron emits (gives out) some energy, then it
"falls" to a lower orbit / lower energy level.
Then, If somebody comes along and gives it
more energy, it can rise to a higher orbit / higher
energy level.
And if they give it enough energy, then it can
escape from the atom all together !

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Ithink the answer would be a