History, 26.01.2021 19:30 carlosgc19

NEED HELP ASAP FRENCH REVOLUTION

What rights do people have, and where do they come from?
Who gets to make decisions for others; and on what authority?
And how can we organize society to meet people's needs?

Answers: 1

Show answers

Another question on History

History, 21.06.2019 12:30

New industry and wealth, plans to expand power in the pacific, and new military power were similarities between the united states and in the early 1900s. a) russia b) japan c) china d) britain

Answers: 1

Answer

History, 21.06.2019 16:30

Where did the domestication of crops and animals begin?

Answers: 1

Answer

History, 22.06.2019 04:30

How long was the peasants’ work day?

Answers: 1

Answer

History, 22.06.2019 07:30

Who was william mckinley? what platform did he run on?

Answers: 1

Answer

You know the right answer?

NEED HELP ASAP FRENCH REVOLUTION

What rights do people have, and where do they come fro...

Questions

Business, 28.09.2019 03:20

Laverne and shirley started a partnership. laverne invested $4,000 in the business and shirley invested $6,000. the partnership agreement stipulated t...

Chemistry, 28.09.2019 03:20

Asolid sample (sample 1) is analyzed and found to contain 1.47 g carbon and 0.123 g hydrogen. a second sample (sample 2) is expected to be composed of...

Chemistry, 28.09.2019 03:20

Select 2-possible ointment bases. select one or more: a. hypromellose and cacl2 b. xanthan gum c. petroleum jelly...

Social Studies, 28.09.2019 03:20

When zeneida is preparing her persuasive speech about why we should use a refillable water bottle instead of buying disposable water bottles. she make...

Social Studies, 28.09.2019 03:20

The history of intercollegiate athletics illustrates that, from the beginning, which of the following was true? a. marketing and sponsorship were impo...

Chemistry, 28.09.2019 03:20

Calculate the freezing temperature of the following solution of 0.50 m glucose (a covalent compound). assume that the molality of the solution is 0.50...

Chemistry, 28.09.2019 03:20

What volume of concentrated (10.2 m) hcl would be required to prepare 1.11 x 104 ml of 1.5 m hc1? enter your answer in scientific notation. be sure t...

Chemistry, 28.09.2019 03:20

Enter your answer in the provided box. calculate the composition of the following solution in mass/volume % 0.600 g naoh per 2.00 ml % naoh...

Chemistry, 28.09.2019 03:20

Calculate the volume of a 0.200 m kcl solution containing 5.00 10-2 mol of solute. enter your answer in the provided box. il...

Chemistry, 28.09.2019 03:20

Dielectrics 583 reflect as w creases when the es some energy sct as we would expect, the potential difference when the capacitors are connected becaus...

Chemistry, 28.09.2019 03:20

Calculate the molarity of a solution that contains 3.11 mol of nano3 dissolved in 2.50 l. enter your answer in the provided box....

Chemistry, 28.09.2019 03:20

A7.00-ml portion of 8.00 m stock solution is to be diluted to 0.800 m. what will be the final volume after dilution? enter your answer in scientific...

Chemistry, 28.09.2019 03:20

Iam performing a q-test on absorbance values. my values are: 0.585, 0.593, 0.594, 0.596, 0.596, 0.597, 0.598, 0.599, 0.621, and 0.627. 10...

Chemistry, 28.09.2019 03:20

Aconsistent explanation of known observations is called a) an experiment. b) a prediction. c) a hypothesis. theory...

Chemistry, 28.09.2019 03:20

The factor 0.01 corresponds to which prefix? a) milli b) deci c) deka d) centi...

Chemistry, 28.09.2019 03:20

Give the names for each of the elements between atomic numbers 1 and 86 that has a symbol starting with "c". identify the family each elem...

Chemistry, 28.09.2019 03:20

Which of the following is an example of a qualitative measurement? a) blue crystal b) 2 moles of carbon atoms c) 10 g of salt d) 12 dl. of water...

Chemistry, 28.09.2019 03:20

Convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. ch: coch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: ch-...

Social Studies, 28.09.2019 03:20

Margo sees her new classmate, fotima, a recent immigrant from haiti, put all of the extra bread, rolls, butter, and cookies into her backpack at lunch...

Chemistry, 28.09.2019 03:20

What symbol is used to express the factor, 10-6? a) b) m c) n d) m...

More questions: History Another questions

NEED HELP ASAP FRENCH REVOLUTION What rights do people have, and where do they come from? Who gets to make decisions for others; and on what authority? And how can we organize society to meet people's needs?

Answers

Another question on History

NEED HELP ASAP FRENCH REVOLUTION

What rights do people have, and where do they come from?
Who gets to make decisions for others; and on what authority?
And how can we organize society to meet people's needs?