subject
Mathematics, 06.05.2020 17:08 foriegnngal

Cos(80)cot(50)+sin(80)sin(50)

ansver
Answers: 3

Another question on Mathematics

question
Mathematics, 21.06.2019 15:00
The inside wheels of a car traveling on a circular path are rotating half as fast as the outside wheels. the front two wheels are six feet apart. what is the number of feet in the path traced by the inside front wheel in one trip around the circle? express your answer in the form "k \pi", where k is an integer.
Answers: 3
question
Mathematics, 21.06.2019 15:20
Asmall (but heavy) particle placed in a glass of water will follow a zigzag motion because the particle will bounce off of the water molecules it meets. this is called brownian motion. a physicist simulates this on a computer, by varying the distance a particle can travel (called the mean free length), on average, before it collides with a water molecule and assigning the change in motion to be one of 8 directions, each with a similar probability. by running the simulated particle (with the same mean free length) many times she determines that it should take 15 seconds, on average, for the particle to fall to the bottom, with a standard deviation of 1.5 seconds. next she lets a real particle fall through a glass of water and finds that it took 18 seconds. what does she conclude, and why?
Answers: 1
question
Mathematics, 21.06.2019 20:30
If m∠abc = 70°, what is m∠abd? justify your reasoning.  using the addition property of equality, 40 + 70 = 110, so m∠abd = 110°.  using the subtraction property of equality, 70 − 30 = 40, so m∠abd = 30°.  using the angle addition postulate, 40 + m∠abd = 70. so, m∠abd = 30° using the subtraction property of equality.  using the angle addition postulate, 40 + 70 = m∠abd. so, m∠abd = 110° using the addition property of equality.
Answers: 2
question
Mathematics, 21.06.2019 23:00
What ia the sum if the first 7 terms of the geometric series
Answers: 2
You know the right answer?
Cos(80)cot(50)+sin(80)sin(50)...
Questions
question
Mathematics, 01.04.2021 22:40
question
Mathematics, 01.04.2021 22:40
Questions on the website: 13722363