Physics, 24.10.2019 05:43 rfieldgrove8512

Marion rides her racing bicycle at a speed of 8 m/s. the bicyle wheels have a radius of 34 cm.
a. what is the angular speed of the wheels?
b. how many times does each wheel go around during a 10 minute ride?

Answers: 2

Show answers

Answers

Answer from: Tyrant4life

Part A) The angular speed of the wheels is $23.53\frac{rad}{sec}$

Part B) Approximately 2,247 revolutions

Explanation:

Part A) What is the angular speed of the wheels?

we know that

The Angular speed is equal to divide the Linear speed by the radius

Let

s -----> the linear speed in m/sec

r -----> radius in m

w ----> angular speed in rad/sec

$w=\frac{s}{r}$

we have

$s=8\ m/sec\\r=34\ cm=34/100=0.34\ m$

substitute

$w=\frac{8}{0.34}$

$w=23.53\frac{rad}{sec}$

Part B) How many times does each wheel go round during a 10-minute ride?

we know that

As the wheel rotates one time, a point on the wheel rotates 2π radians.

Remember that

$10\ minutes = 600\ seconds$

$\theta = w * t = (\frac{8}{0.34}) * 600= \frac{4,800}{0.34}\ radians$

To find out the number of rotations divide by 2π

$\frac{\frac{4,800}{0.34}}{2\pi}=2,246.9$

Approximately 2,247 revolutions

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Centrapedial force is the answer

Another question on Physics

Physics, 22.06.2019 04:10

Unpolarized light of intensity so passes through two sheets of polarizing material whose transmission axes make an angle of 60∘ with each other as shown in the figure. what is the intensity of the transmitted beam, st?

Answers: 3

Answer

Physics, 22.06.2019 07:00

Aball has an initial velocity of 3 m/s. if there is no friction, what is the highest it could roll?

Answers: 1

Answer

Physics, 22.06.2019 14:10

In one or two sentences, describe how you did in the balancing game. in a few more sentences, explain one strategy you learned for balancing more complex equations.

Answers: 2

Answer

Physics, 22.06.2019 18:10

Which of the following statement is false

Answers: 2

Answer

You know the right answer?

Marion rides her racing bicycle at a speed of 8 m/s. the bicyle wheels have a radius of 34 cm.
...

Questions