Direction: From the concepts you have learned, let's check your understanding. Write TRUE if the statement is correct and FALSE if the statement is wrong. If the statement is false make it true 1. The standard unit for momentum is kilometer per hour.
2. Velocity and mass are factors affecting the momentum of a body.
3. Moving objects with the same velocity yet vary in mass have the same momenta.
4. Two cars, one twice as heavy as the other, moves down a hill at the same time. The heavier car would have a greater momentum.
5. The newton's first law of inertia is also known as the inertia in motion.
6.A car at rest has zero velocity hence it has lesser momentum.
7. Unbalanced forces cause the object at the rest to move.
8. Momentum depends solely on the mass of an object.
9. The momentum of an object is equal to the mass of the object divided by the velocity of the object.
10. Stationary object with no velocity has zero momentum​

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

It equals just about 6,300 km per hour each day an week