PAPER ONE 1. Calipers, micrometers and rulers are instruments for measuring length. Which of
these instruments usually have Vernier Scales?
A. Caliper and micrometer B. Caliper and ruler
C. Micrometer and ruler
D. Caliper, micrometer and ruler
2. Which of the following may be used to calculate density?
A. Volume
B. Volume
C. Mass D. Volume x mass
Weight
Mass
Volume
3. Brakes are used to stop a car. What is most of the kinetic energy converted into?
A. Heat energy
B. Light energy
C. Potential energy
D. Sound energy
4.
An experiment rocket has a mass of 3kg. It is fired vertically upwards and reaches
a height of 100m. What is its change in gravitational potential energy?
(g = 10N/kg)
C. 300J
D. 3000)
B. 30J
A. OJ
5. A horizontal force of 8N is applied to a block of mass 2kg resting on a frictionless
table. What is the acceleration of the block?
D. 16m/s2
A. 0.25m/s2
B. 4.0m/s? C. 6.0m/s2
6. A stone of mass 40g is lowered into a measuring cylinder. The water level rises as
shown.​

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o